C18H18Cl3IN2O3 — CID 166706672
3-chloro-6-(2,6-dichloro-4-iodophenoxy)-4-[3-[(2R)-oxan-2-yl]oxypropyl]pyridazine (PubChem CID 166706672) has the molecular formula C18H18Cl3IN2O3 and a molecular weight of 543.62 g/mol. Its IUPAC name is 3-chloro-6-(2,6-dichloro-4-iodophenoxy)-4-[3-[(2R)-oxan-2-yl]oxypropyl]pyridazine.
| Compound Name | 3-chloro-6-(2,6-dichloro-4-iodophenoxy)-4-[3-[(2R)-oxan-2-yl]oxypropyl]pyridazine |
|---|---|
| PubChem CID | 166706672 |
| Molecular Formula | C18H18Cl3IN2O3 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 541.94 |
| IUPAC Name | 3-chloro-6-(2,6-dichloro-4-iodophenoxy)-4-[3-[(2R)-oxan-2-yl]oxypropyl]pyridazine |
| SMILES | Clc1cc(I)cc(Cl)c1Oc1cc(CCCO[C@@H]2CCCCO2)c(Cl)nn1 |
| InChI | InChI=1S/C18H18Cl3IN2O3/c19-13-9-12(22)10-14(20)17(13)27-15-8-11(18(21)24-23-15)4-3-7-26-16-5-1-2-6-25-16/h8-10,16H,1-7H2/t16-/m1/s1 |
| InChIKey | JSLYTRWRFWVRLV-MRXNPFEDSA-N |
| XLogP | 6.31 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|