C14H22N2 — CID 166707337
2-N-methyl-2-N-(2-methylphenyl)-1-N-propylprop-2-ene-1,2-diamine (PubChem CID 166707337) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-N-methyl-2-N-(2-methylphenyl)-1-N-propylprop-2-ene-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-(2-methylphenyl)-1-N-propylprop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 166707337 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-N-methyl-2-N-(2-methylphenyl)-1-N-propylprop-2-ene-1,2-diamine |
| SMILES | C=C(CNCCC)N(C)c1ccccc1C |
| InChI | InChI=1S/C14H22N2/c1-5-10-15-11-13(3)16(4)14-9-7-6-8-12(14)2/h6-9,15H,3,5,10-11H2,1-2,4H3 |
| InChIKey | RGWOXJJDQDGCDQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|