C17H29N — CID 142020927
N,2-dimethyl-N-(2-methylhex-2-en-3-yl)aniline;ethane (PubChem CID 142020927) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is N,2-dimethyl-N-(2-methylhex-2-en-3-yl)aniline;ethane.
| Compound Name | N,2-dimethyl-N-(2-methylhex-2-en-3-yl)aniline;ethane |
|---|---|
| PubChem CID | 142020927 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N,2-dimethyl-N-(2-methylhex-2-en-3-yl)aniline;ethane |
| SMILES | CC.CCCC(=C(C)C)N(C)c1ccccc1C |
| InChI | InChI=1S/C15H23N.C2H6/c1-6-9-14(12(2)3)16(5)15-11-8-7-10-13(15)4;1-2/h7-8,10-11H,6,9H2,1-5H3;1-2H3 |
| InChIKey | KXGFUKLAYOLWDE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |