C24H22N4O2S — CID 16670984
2-[[1-(isoquinoline-1-carbonyl)piperidin-4-yl]methyl]-6-thiophen-2-ylpyridazin-3-one (PubChem CID 16670984) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[[1-(isoquinoline-1-carbonyl)piperidin-4-yl]methyl]-6-thiophen-2-ylpyridazin-3-one.
| Compound Name | 2-[[1-(isoquinoline-1-carbonyl)piperidin-4-yl]methyl]-6-thiophen-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 16670984 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[[1-(isoquinoline-1-carbonyl)piperidin-4-yl]methyl]-6-thiophen-2-ylpyridazin-3-one |
| SMILES | O=C(c1nccc2ccccc12)N1CCC(Cn2nc(-c3cccs3)ccc2=O)CC1 |
| InChI | InChI=1S/C24H22N4O2S/c29-22-8-7-20(21-6-3-15-31-21)26-28(22)16-17-10-13-27(14-11-17)24(30)23-19-5-2-1-4-18(19)9-12-25-23/h1-9,12,15,17H,10-11,13-14,16H2 |
| InChIKey | VTEWRMUYLCFHOL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |