C20H21N3O2S2 — CID 16672134
6-thiophen-2-yl-2-[[(3S)-1-(2-thiophen-3-ylacetyl)piperidin-3-yl]methyl]pyridazin-3-one (PubChem CID 16672134) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 6-thiophen-2-yl-2-[[(3S)-1-(2-thiophen-3-ylacetyl)piperidin-3-yl]methyl]pyridazin-3-one.
| Compound Name | 6-thiophen-2-yl-2-[[(3S)-1-(2-thiophen-3-ylacetyl)piperidin-3-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 16672134 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 6-thiophen-2-yl-2-[[(3S)-1-(2-thiophen-3-ylacetyl)piperidin-3-yl]methyl]pyridazin-3-one |
| SMILES | O=C(Cc1ccsc1)N1CCC[C@H](Cn2nc(-c3cccs3)ccc2=O)C1 |
| InChI | InChI=1S/C20H21N3O2S2/c24-19-6-5-17(18-4-2-9-27-18)21-23(19)13-16-3-1-8-22(12-16)20(25)11-15-7-10-26-14-15/h2,4-7,9-10,14,16H,1,3,8,11-13H2/t16-/m0/s1 |
| InChIKey | VVLNDKUITGHUDE-INIZCTEOSA-N |
| XLogP | 3.51 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |