C29H37N8O5PS — CID 166711901
2,2-dimethylpropyl (2R)-2-[[[(2S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-iminooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate (PubChem CID 166711901) has the molecular formula C29H37N8O5PS and a molecular weight of 640.71 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2R)-2-[[[(2S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-iminooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2R)-2-[[[(2S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-iminooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 166711901 |
| Molecular Formula | C29H37N8O5PS |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 2,2-dimethylpropyl (2R)-2-[[[(2S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-iminooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
| SMILES | [H]/N=C1\C[C@@H](CO[P@](=S)(N[C@H](C)C(=O)OCC(C)(C)C)Oc2cccc3ccccc23)O[C@H]1n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C29H37N8O5PS/c1-17(27(38)39-15-29(2,3)4)36-43(44,42-22-12-8-10-18-9-6-7-11-20(18)22)40-14-19-13-21(30)26(41-19)37-16-33-23-24(32-5)34-28(31)35-25(23)37/h6-12,16-17,19,26,30H,13-15H2,1-5H3,(H,36,44)(H3,31,32,34,35)/b30-21+/t17-,19+,26-,43-/m1/s1 |
| InChIKey | TWCXNWIRTDDXHL-JUOAYTDZSA-N |
| XLogP | 4.80 |
| TPSA | 171.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|