C36H50N6O4 — CID 166714799
4-[3-[2-[2-(butanoylamino)ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene-13-carbonyl]-N,2-diethyl-2,4-dimethylhexanamide (PubChem CID 166714799) has the molecular formula C36H50N6O4 and a molecular weight of 630.83 g/mol. Its IUPAC name is 4-[3-[2-[2-(butanoylamino)ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene-13-carbonyl]-N,2-diethyl-2,4-dimethylhexanamide.
| Compound Name | 4-[3-[2-[2-(butanoylamino)ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene-13-carbonyl]-N,2-diethyl-2,4-dimethylhexanamide |
|---|---|
| PubChem CID | 166714799 |
| Molecular Formula | C36H50N6O4 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | 4-[3-[2-[2-(butanoylamino)ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene-13-carbonyl]-N,2-diethyl-2,4-dimethylhexanamide |
| SMILES | CCCC(=O)NCCOCCn1nnc2c1-c1ccccc1CN(C(=O)C(C)(CC)CC(C)(CC)C(=O)NCC)c1ccccc1-2 |
| InChI | InChI=1S/C36H50N6O4/c1-7-15-30(43)38-20-22-46-23-21-42-32-27-17-12-11-16-26(27)24-41(29-19-14-13-18-28(29)31(32)39-40-42)34(45)36(6,9-3)25-35(5,8-2)33(44)37-10-4/h11-14,16-19H,7-10,15,20-25H2,1-6H3,(H,37,44)(H,38,43) |
| InChIKey | JMXXLGWSKBKBFD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|