C21H37N3 — CID 166715240
1-N-(2-hept-6-enylphenyl)-3-N-[3-(methylamino)propyl]butane-1,3-diamine (PubChem CID 166715240) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 1-N-(2-hept-6-enylphenyl)-3-N-[3-(methylamino)propyl]butane-1,3-diamine.
| Compound Name | 1-N-(2-hept-6-enylphenyl)-3-N-[3-(methylamino)propyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 166715240 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 1-N-(2-hept-6-enylphenyl)-3-N-[3-(methylamino)propyl]butane-1,3-diamine |
| SMILES | C=CCCCCCc1ccccc1NCCC(C)NCCCNC |
| InChI | InChI=1S/C21H37N3/c1-4-5-6-7-8-12-20-13-9-10-14-21(20)24-18-15-19(2)23-17-11-16-22-3/h4,9-10,13-14,19,22-24H,1,5-8,11-12,15-18H2,2-3H3 |
| InChIKey | HBLSTSZHTRNDOL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|