C21H34N2 — CID 143153357
N,2-dimethyl-N'-[(Z)-pent-3-en-2-yl]-N'-(2-pent-4-enylphenyl)propane-1,3-diamine (PubChem CID 143153357) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is N,2-dimethyl-N'-[(Z)-pent-3-en-2-yl]-N'-(2-pent-4-enylphenyl)propane-1,3-diamine.
| Compound Name | N,2-dimethyl-N'-[(Z)-pent-3-en-2-yl]-N'-(2-pent-4-enylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 143153357 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N,2-dimethyl-N'-[(Z)-pent-3-en-2-yl]-N'-(2-pent-4-enylphenyl)propane-1,3-diamine |
| SMILES | C=CCCCc1ccccc1N(CC(C)CNC)C(C)/C=C\C |
| InChI | InChI=1S/C21H34N2/c1-6-8-9-13-20-14-10-11-15-21(20)23(19(4)12-7-2)17-18(3)16-22-5/h6-7,10-12,14-15,18-19,22H,1,8-9,13,16-17H2,2-5H3/b12-7- |
| InChIKey | NFNZBRNGFCFJCC-GHXNOFRVSA-N |
| XLogP | 4.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|