C21H26N2 — CID 166715855
(1R,2S)-1,2,20-trimethyl-12,20-diazapentacyclo[10.8.0.02,5.06,11.013,18]icosa-3,6(11),7,14,16-pentaene (PubChem CID 166715855) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (1R,2S)-1,2,20-trimethyl-12,20-diazapentacyclo[10.8.0.02,5.06,11.013,18]icosa-3,6(11),7,14,16-pentaene.
| Compound Name | (1R,2S)-1,2,20-trimethyl-12,20-diazapentacyclo[10.8.0.02,5.06,11.013,18]icosa-3,6(11),7,14,16-pentaene |
|---|---|
| PubChem CID | 166715855 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (1R,2S)-1,2,20-trimethyl-12,20-diazapentacyclo[10.8.0.02,5.06,11.013,18]icosa-3,6(11),7,14,16-pentaene |
| SMILES | CN1CC2C=CC=CC2N2C3=C(C=CCC3)C3C=C[C@]3(C)[C@]12C |
| InChI | InChI=1S/C21H26N2/c1-20-13-12-17(20)16-9-5-7-11-19(16)23-18-10-6-4-8-15(18)14-22(3)21(20,23)2/h4-6,8-10,12-13,15,17-18H,7,11,14H2,1-3H3/t15?,17?,18?,20-,21+/m0/s1 |
| InChIKey | XRHZGXNZCJXWBZ-BVEOMGIMSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|