C10H16N4O — CID 166718579
1-[(Z)-but-2-enyl]-1,3-dimethanimidoyl-3-[(Z)-prop-1-enyl]urea (PubChem CID 166718579) has the molecular formula C10H16N4O and a molecular weight of 208.27 g/mol. Its IUPAC name is 1-[(Z)-but-2-enyl]-1,3-dimethanimidoyl-3-[(Z)-prop-1-enyl]urea.
| Compound Name | 1-[(Z)-but-2-enyl]-1,3-dimethanimidoyl-3-[(Z)-prop-1-enyl]urea |
|---|---|
| PubChem CID | 166718579 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-[(Z)-but-2-enyl]-1,3-dimethanimidoyl-3-[(Z)-prop-1-enyl]urea |
| SMILES | [H]/N=C/N(/C=C\C)C(=O)N(/C=N/[H])C/C=C\C |
| InChI | InChI=1S/C10H16N4O/c1-3-5-7-14(9-12)10(15)13(8-11)6-4-2/h3-6,8-9,11-12H,7H2,1-2H3/b5-3-,6-4-,11-8+,12-9+ |
| InChIKey | FTULBTMEXACSOP-YYRSYOBQSA-N |
| XLogP | 2.03 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|