C10H14BrF2NO — CID 102091543
2-bromo-N,N-bis[(E)-but-2-enyl]-2,2-difluoroacetamide (PubChem CID 102091543) has the molecular formula C10H14BrF2NO and a molecular weight of 282.13 g/mol. Its IUPAC name is 2-bromo-N,N-bis[(E)-but-2-enyl]-2,2-difluoroacetamide.
| Compound Name | 2-bromo-N,N-bis[(E)-but-2-enyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 102091543 |
| Molecular Formula | C10H14BrF2NO |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 2-bromo-N,N-bis[(E)-but-2-enyl]-2,2-difluoroacetamide |
| SMILES | C/C=C/CN(C/C=C/C)C(=O)C(F)(F)Br |
| InChI | InChI=1S/C10H14BrF2NO/c1-3-5-7-14(8-6-4-2)9(15)10(11,12)13/h3-6H,7-8H2,1-2H3/b5-3+,6-4+ |
| InChIKey | JAZPPQFUHZKNKL-GGWOSOGESA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|