C8H8Br3Cl2NO — CID 54480638
2,2,2-tribromo-N,N-bis(3-chloroprop-2-enyl)acetamide (PubChem CID 54480638) has the molecular formula C8H8Br3Cl2NO and a molecular weight of 444.78 g/mol. Its IUPAC name is 2,2,2-tribromo-N,N-bis(3-chloroprop-2-enyl)acetamide.
| Compound Name | 2,2,2-tribromo-N,N-bis(3-chloroprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 54480638 |
| Molecular Formula | C8H8Br3Cl2NO |
| Molecular Weight | 444.78 g/mol |
| Exact Mass | 440.75 |
| IUPAC Name | 2,2,2-tribromo-N,N-bis(3-chloroprop-2-enyl)acetamide |
| SMILES | O=C(N(CC=CCl)CC=CCl)C(Br)(Br)Br |
| InChI | InChI=1S/C8H8Br3Cl2NO/c9-8(10,11)7(15)14(5-1-3-12)6-2-4-13/h1-4H,5-6H2 |
| InChIKey | XOTIWINDRQHXOK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|