C25H20ClF5N4O3S — CID 166719160
1-N'-[5-[[2-chloro-5-(trifluoromethyl)anilino]-hydroxymethyl]-4-cyclopropyl-1,3-thiazol-2-yl]-1-N-(3,5-difluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 166719160) has the molecular formula C25H20ClF5N4O3S and a molecular weight of 586.97 g/mol. Its IUPAC name is 1-N'-[5-[[2-chloro-5-(trifluoromethyl)anilino]-hydroxymethyl]-4-cyclopropyl-1,3-thiazol-2-yl]-1-N-(3,5-difluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[5-[[2-chloro-5-(trifluoromethyl)anilino]-hydroxymethyl]-4-cyclopropyl-1,3-thiazol-2-yl]-1-N-(3,5-difluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 166719160 |
| Molecular Formula | C25H20ClF5N4O3S |
| Molecular Weight | 586.97 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | 1-N'-[5-[[2-chloro-5-(trifluoromethyl)anilino]-hydroxymethyl]-4-cyclopropyl-1,3-thiazol-2-yl]-1-N-(3,5-difluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)C1(C(=O)Nc2nc(C3CC3)c(C(O)Nc3cc(C(F)(F)F)ccc3Cl)s2)CC1 |
| InChI | InChI=1S/C25H20ClF5N4O3S/c26-16-4-3-12(25(29,30)31)7-17(16)33-20(36)19-18(11-1-2-11)34-23(39-19)35-22(38)24(5-6-24)21(37)32-15-9-13(27)8-14(28)10-15/h3-4,7-11,20,33,36H,1-2,5-6H2,(H,32,37)(H,34,35,38) |
| InChIKey | KWEBQGZUAZJEQE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|