C19H16ClF3N2O2 — CID 108981000
1-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-N'-methyl-1-N'-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 108981000) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is 1-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-N'-methyl-1-N'-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-N'-methyl-1-N'-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108981000 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-N'-methyl-1-N'-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | CN(C(=O)C1(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H16ClF3N2O2/c1-25(13-5-3-2-4-6-13)17(27)18(9-10-18)16(26)24-15-11-12(19(21,22)23)7-8-14(15)20/h2-8,11H,9-10H2,1H3,(H,24,26) |
| InChIKey | KABAFIQKJSMTBT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|