C18H18FN3O2S — CID 168737766
1-N'-(4-cyclopropyl-5-methyl-1,3-thiazol-2-yl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 168737766) has the molecular formula C18H18FN3O2S and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-N'-(4-cyclopropyl-5-methyl-1,3-thiazol-2-yl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-cyclopropyl-5-methyl-1,3-thiazol-2-yl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 168737766 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-N'-(4-cyclopropyl-5-methyl-1,3-thiazol-2-yl)-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1sc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)nc1C1CC1 |
| InChI | InChI=1S/C18H18FN3O2S/c1-10-14(11-2-3-11)21-17(25-10)22-16(24)18(8-9-18)15(23)20-13-6-4-12(19)5-7-13/h4-7,11H,2-3,8-9H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | AYPMJSIZXXQVPX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|