C27H44O4 — CID 166720246
methyl (3R)-3-[(1R,2R)-2-[2-[(6S,8aR)-6-acetyloxy-2,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2-methylcyclopentyl]butanoate (PubChem CID 166720246) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is methyl (3R)-3-[(1R,2R)-2-[2-[(6S,8aR)-6-acetyloxy-2,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2-methylcyclopentyl]butanoate.
| Compound Name | methyl (3R)-3-[(1R,2R)-2-[2-[(6S,8aR)-6-acetyloxy-2,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2-methylcyclopentyl]butanoate |
|---|---|
| PubChem CID | 166720246 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | methyl (3R)-3-[(1R,2R)-2-[2-[(6S,8aR)-6-acetyloxy-2,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2-methylcyclopentyl]butanoate |
| SMILES | COC(=O)C[C@@H](C)[C@H]1CCC[C@]1(C)CCC1C(C)CC=C2C[C@@H](OC(C)=O)CC[C@@]21C |
| InChI | InChI=1S/C27H44O4/c1-18-9-10-21-17-22(31-20(3)28)11-15-27(21,5)24(18)12-14-26(4)13-7-8-23(26)19(2)16-25(29)30-6/h10,18-19,22-24H,7-9,11-17H2,1-6H3/t18?,19-,22+,23-,24?,26-,27+/m1/s1 |
| InChIKey | HRONYILATIVXES-LTXLRQGQSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|