C10H18N2 — CID 166726198
(Z)-2-[[(E)-2,4-dimethylhex-2-enylidene]amino]ethenamine (PubChem CID 166726198) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (Z)-2-[[(E)-2,4-dimethylhex-2-enylidene]amino]ethenamine.
| Compound Name | (Z)-2-[[(E)-2,4-dimethylhex-2-enylidene]amino]ethenamine |
|---|---|
| PubChem CID | 166726198 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (Z)-2-[[(E)-2,4-dimethylhex-2-enylidene]amino]ethenamine |
| SMILES | CCC(C)/C=C(C)/C=N/C=C\N |
| InChI | InChI=1S/C10H18N2/c1-4-9(2)7-10(3)8-12-6-5-11/h5-9H,4,11H2,1-3H3/b6-5-,10-7+,12-8+ |
| InChIKey | RKUNNHIZKVPGBF-AUTLXHKSSA-N |
| XLogP | 2.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|