C15H20O3 — CID 166726203
(3E)-1-methoxy-2-methyl-5-phenylmethoxyhexa-3,5-dien-3-ol (PubChem CID 166726203) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3E)-1-methoxy-2-methyl-5-phenylmethoxyhexa-3,5-dien-3-ol.
| Compound Name | (3E)-1-methoxy-2-methyl-5-phenylmethoxyhexa-3,5-dien-3-ol |
|---|---|
| PubChem CID | 166726203 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3E)-1-methoxy-2-methyl-5-phenylmethoxyhexa-3,5-dien-3-ol |
| SMILES | C=C(/C=C(/O)C(C)COC)OCc1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-12(10-17-3)15(16)9-13(2)18-11-14-7-5-4-6-8-14/h4-9,12,16H,2,10-11H2,1,3H3/b15-9+ |
| InChIKey | UGSWIDLIVMKOMU-OQLLNIDSSA-N |
| XLogP | 3.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|