C11H20OS — CID 166726900
(1S,5R)-3-tert-butyl-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 166726900) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is (1S,5R)-3-tert-butyl-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,5R)-3-tert-butyl-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 166726900 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (1S,5R)-3-tert-butyl-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)(C)C1(O)C[C@H]2CC[C@@H](C1)S2 |
| InChI | InChI=1S/C11H20OS/c1-10(2,3)11(12)6-8-4-5-9(7-11)13-8/h8-9,12H,4-7H2,1-3H3/t8-,9+,11? |
| InChIKey | VBNXSNJOMUNRBM-SLHIUPAKSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |