C30H40N4O4 — CID 166729846
tert-butyl 6-[4-[4-[(2-hydroxy-6-oxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 166729846) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is tert-butyl 6-[4-[4-[(2-hydroxy-6-oxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 6-[4-[4-[(2-hydroxy-6-oxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 166729846 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | tert-butyl 6-[4-[4-[(2-hydroxy-6-oxopiperidin-3-yl)amino]phenyl]piperidin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(N3CCC(c4ccc(NC5CCC(=O)NC5O)cc4)CC3)ccc2C1 |
| InChI | InChI=1S/C30H40N4O4/c1-30(2,3)38-29(37)34-17-14-22-18-25(9-6-23(22)19-34)33-15-12-21(13-16-33)20-4-7-24(8-5-20)31-26-10-11-27(35)32-28(26)36/h4-9,18,21,26,28,31,36H,10-17,19H2,1-3H3,(H,32,35) |
| InChIKey | PXZKDEHITHDVRM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|