C25H19Br2F6N3O6S2 — CID 166732295
N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide;6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide (PubChem CID 166732295) has the molecular formula C25H19Br2F6N3O6S2 and a molecular weight of 795.37 g/mol. Its IUPAC name is N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide;6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide.
| Compound Name | N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide;6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
|---|---|
| PubChem CID | 166732295 |
| Molecular Formula | C25H19Br2F6N3O6S2 |
| Molecular Weight | 795.37 g/mol |
| Exact Mass | 792.90 |
| IUPAC Name | N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide;6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)S(=O)(=O)CCO1.Cc1nc(C(F)(F)F)c(C(=O)Nc2c(Br)cc(OC(F)(F)F)cc2Br)s1 |
| InChI | InChI=1S/C13H6Br2F6N2O2S.C12H13NO4S/c1-4-22-10(12(16,17)18)9(26-4)11(24)23-8-6(14)2-5(3-7(8)15)25-13(19,20)21;1-9-11(18(15,16)8-7-17-9)12(14)13-10-5-3-2-4-6-10/h2-3H,1H3,(H,23,24);2-6H,7-8H2,1H3,(H,13,14) |
| InChIKey | VKYSNVUOGNOUQF-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.37 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |