C24H26N2O6S2 — CID 68943193
6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide;6-methyl-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide (PubChem CID 68943193) has the molecular formula C24H26N2O6S2 and a molecular weight of 502.61 g/mol. Its IUPAC name is 6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide;6-methyl-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide.
| Compound Name | 6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide;6-methyl-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
|---|---|
| PubChem CID | 68943193 |
| Molecular Formula | C24H26N2O6S2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 6-methyl-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide;6-methyl-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)S(=O)(=O)CCO1.CC1=C(C(=O)Nc2ccccc2)SCCO1 |
| InChI | InChI=1S/C12H13NO4S.C12H13NO2S/c1-9-11(18(15,16)8-7-17-9)12(14)13-10-5-3-2-4-6-10;1-9-11(16-8-7-15-9)12(14)13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14);2-6H,7-8H2,1H3,(H,13,14) |
| InChIKey | RJTZXRVBJCCJSH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |