C12H12BrNO4S — CID 11725146
6-(bromomethyl)-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide (PubChem CID 11725146) has the molecular formula C12H12BrNO4S and a molecular weight of 346.20 g/mol. Its IUPAC name is 6-(bromomethyl)-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide.
| Compound Name | 6-(bromomethyl)-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
|---|---|
| PubChem CID | 11725146 |
| Molecular Formula | C12H12BrNO4S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 6-(bromomethyl)-4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=C(CBr)OCCS1(=O)=O |
| InChI | InChI=1S/C12H12BrNO4S/c13-8-10-11(19(16,17)7-6-18-10)12(15)14-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,14,15) |
| InChIKey | ZWWQIAMXVWPOEF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|