C11H11NO4S — CID 22750388
4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide (PubChem CID 22750388) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide.
| Compound Name | 4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
|---|---|
| PubChem CID | 22750388 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4,4-dioxo-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=COCCS1(=O)=O |
| InChI | InChI=1S/C11H11NO4S/c13-11(12-9-4-2-1-3-5-9)10-8-16-6-7-17(10,14)15/h1-5,8H,6-7H2,(H,12,13) |
| InChIKey | RIGABGWGEKUBHP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |