C17H15NO5S2 — CID 1271299
1,1,4,4-tetraoxo-N,6-diphenyl-2,3-dihydro-1,4-dithiine-5-carboxamide (PubChem CID 1271299) has the molecular formula C17H15NO5S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1,1,4,4-tetraoxo-N,6-diphenyl-2,3-dihydro-1,4-dithiine-5-carboxamide.
| Compound Name | 1,1,4,4-tetraoxo-N,6-diphenyl-2,3-dihydro-1,4-dithiine-5-carboxamide |
|---|---|
| PubChem CID | 1271299 |
| Molecular Formula | C17H15NO5S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 1,1,4,4-tetraoxo-N,6-diphenyl-2,3-dihydro-1,4-dithiine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=C(c2ccccc2)S(=O)(=O)CCS1(=O)=O |
| InChI | InChI=1S/C17H15NO5S2/c19-17(18-14-9-5-2-6-10-14)16-15(13-7-3-1-4-8-13)24(20,21)11-12-25(16,22)23/h1-10H,11-12H2,(H,18,19) |
| InChIKey | NZRLBYAVNUTULU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |