C10H8Cl2N2OS — CID 139626196
1,1-dichloro-N-phenyl-1,2-thiazole-5-carboxamide (PubChem CID 139626196) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is 1,1-dichloro-N-phenyl-1,2-thiazole-5-carboxamide.
| Compound Name | 1,1-dichloro-N-phenyl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 139626196 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 1,1-dichloro-N-phenyl-1,2-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=CC=NS1(Cl)Cl |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-16(12)9(6-7-13-16)10(15)14-8-4-2-1-3-5-8/h1-7H,(H,14,15) |
| InChIKey | QHVRIEMTZDYDRX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |