C18H34N2 — CID 166733275
N,1-di(propan-2-yl)-4,4a,5,6,7,8,9,10,11,11a-decahydro-3H-cyclonona[b]pyridin-2-imine (PubChem CID 166733275) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is N,1-di(propan-2-yl)-4,4a,5,6,7,8,9,10,11,11a-decahydro-3H-cyclonona[b]pyridin-2-imine.
| Compound Name | N,1-di(propan-2-yl)-4,4a,5,6,7,8,9,10,11,11a-decahydro-3H-cyclonona[b]pyridin-2-imine |
|---|---|
| PubChem CID | 166733275 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N,1-di(propan-2-yl)-4,4a,5,6,7,8,9,10,11,11a-decahydro-3H-cyclonona[b]pyridin-2-imine |
| SMILES | CC(C)/N=C1\CCC2CCCCCCCC2N1C(C)C |
| InChI | InChI=1S/C18H34N2/c1-14(2)19-18-13-12-16-10-8-6-5-7-9-11-17(16)20(18)15(3)4/h14-17H,5-13H2,1-4H3/b19-18+ |
| InChIKey | WMDDEAKMTHIQHW-VHEBQXMUSA-N |
| XLogP | 5.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|