C18H34N2O — CID 167191433
10-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[d][1,3]oxazol-2-imine (PubChem CID 167191433) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 10-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[d][1,3]oxazol-2-imine.
| Compound Name | 10-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[d][1,3]oxazol-2-imine |
|---|---|
| PubChem CID | 167191433 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 10-methyl-N,3-di(propan-2-yl)-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[d][1,3]oxazol-2-imine |
| SMILES | CC1CCCCCCC2C(C1)O/C(=N\C(C)C)N2C(C)C |
| InChI | InChI=1S/C18H34N2O/c1-13(2)19-18-20(14(3)4)16-11-9-7-6-8-10-15(5)12-17(16)21-18/h13-17H,6-12H2,1-5H3/b19-18- |
| InChIKey | CPJCCIPNNRXRSY-HNENSFHCSA-N |
| XLogP | 4.61 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|