C14H30FN3O3 — CID 166733715
N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide (PubChem CID 166733715) has the molecular formula C14H30FN3O3 and a molecular weight of 307.41 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 166733715 |
| Molecular Formula | C14H30FN3O3 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethylamino]ethoxy]propyl]acetamide |
| SMILES | CC(=O)NCC(F)COCCNCCOCCNC(C)C |
| InChI | InChI=1S/C14H30FN3O3/c1-12(2)17-6-9-20-7-4-16-5-8-21-11-14(15)10-18-13(3)19/h12,14,16-17H,4-11H2,1-3H3,(H,18,19) |
| InChIKey | LJUSNEJVAINNHS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|