C23H31N3O3 — CID 166736432
[(2S)-1-[6-(1,3-dimethyl-2H-pyridin-5-yl)-2-(oxan-4-yl)benzimidazol-1-yl]propan-2-yl]oxymethanol (PubChem CID 166736432) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is [(2S)-1-[6-(1,3-dimethyl-2H-pyridin-5-yl)-2-(oxan-4-yl)benzimidazol-1-yl]propan-2-yl]oxymethanol.
| Compound Name | [(2S)-1-[6-(1,3-dimethyl-2H-pyridin-5-yl)-2-(oxan-4-yl)benzimidazol-1-yl]propan-2-yl]oxymethanol |
|---|---|
| PubChem CID | 166736432 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | [(2S)-1-[6-(1,3-dimethyl-2H-pyridin-5-yl)-2-(oxan-4-yl)benzimidazol-1-yl]propan-2-yl]oxymethanol |
| SMILES | CC1=CC(c2ccc3nc(C4CCOCC4)n(C[C@H](C)OCO)c3c2)=CN(C)C1 |
| InChI | InChI=1S/C23H31N3O3/c1-16-10-20(14-25(3)12-16)19-4-5-21-22(11-19)26(13-17(2)29-15-27)23(24-21)18-6-8-28-9-7-18/h4-5,10-11,14,17-18,27H,6-9,12-13,15H2,1-3H3/t17-/m0/s1 |
| InChIKey | XUDCHVCYCWJTSI-KRWDZBQOSA-N |
| XLogP | 3.52 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|