C23H30N2O4 — CID 16674031
1-[(2,5-dimethoxy-4-morpholin-4-ylphenyl)methyl]-3-phenylpyrrolidin-3-ol (PubChem CID 16674031) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(2,5-dimethoxy-4-morpholin-4-ylphenyl)methyl]-3-phenylpyrrolidin-3-ol.
| Compound Name | 1-[(2,5-dimethoxy-4-morpholin-4-ylphenyl)methyl]-3-phenylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 16674031 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-[(2,5-dimethoxy-4-morpholin-4-ylphenyl)methyl]-3-phenylpyrrolidin-3-ol |
| SMILES | COc1cc(N2CCOCC2)c(OC)cc1CN1CCC(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H30N2O4/c1-27-21-15-20(25-10-12-29-13-11-25)22(28-2)14-18(21)16-24-9-8-23(26,17-24)19-6-4-3-5-7-19/h3-7,14-15,26H,8-13,16-17H2,1-2H3 |
| InChIKey | OLRWNLSRKLIPTL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|