C15H30N2O4S — CID 166746005
4-[(1S)-1-[tert-butylsulfinyl(2-hydroxypropyl)amino]ethyl]piperidine-1-carboxylic acid (PubChem CID 166746005) has the molecular formula C15H30N2O4S and a molecular weight of 334.48 g/mol. Its IUPAC name is 4-[(1S)-1-[tert-butylsulfinyl(2-hydroxypropyl)amino]ethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(1S)-1-[tert-butylsulfinyl(2-hydroxypropyl)amino]ethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 166746005 |
| Molecular Formula | C15H30N2O4S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-[(1S)-1-[tert-butylsulfinyl(2-hydroxypropyl)amino]ethyl]piperidine-1-carboxylic acid |
| SMILES | CC(O)CN([C@@H](C)C1CCN(C(=O)O)CC1)S(=O)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O4S/c1-11(18)10-17(22(21)15(3,4)5)12(2)13-6-8-16(9-7-13)14(19)20/h11-13,18H,6-10H2,1-5H3,(H,19,20)/t11?,12-,22?/m0/s1 |
| InChIKey | AVZHNYXDJUQRBE-MIXLTESUSA-N |
| XLogP | 1.91 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |