C19H36N2O3S — CID 166745842
tert-butyl 4-[(1S)-1-[tert-butylsulfinyl(prop-2-enyl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 166745842) has the molecular formula C19H36N2O3S and a molecular weight of 372.58 g/mol. Its IUPAC name is tert-butyl 4-[(1S)-1-[tert-butylsulfinyl(prop-2-enyl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1S)-1-[tert-butylsulfinyl(prop-2-enyl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166745842 |
| Molecular Formula | C19H36N2O3S |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tert-butyl 4-[(1S)-1-[tert-butylsulfinyl(prop-2-enyl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | C=CCN([C@@H](C)C1CCN(C(=O)OC(C)(C)C)CC1)S(=O)C(C)(C)C |
| InChI | InChI=1S/C19H36N2O3S/c1-9-12-21(25(23)19(6,7)8)15(2)16-10-13-20(14-11-16)17(22)24-18(3,4)5/h9,15-16H,1,10-14H2,2-8H3/t15-,25?/m0/s1 |
| InChIKey | ZHQLSLSFQQMNCO-JMTKMGNOSA-N |
| XLogP | 3.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|