C18H30N2O4 — CID 138013999
tert-butyl 4-[2-[cyclopropyl(prop-2-enyl)amino]-1-hydroxy-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 138013999) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl 4-[2-[cyclopropyl(prop-2-enyl)amino]-1-hydroxy-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[cyclopropyl(prop-2-enyl)amino]-1-hydroxy-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138013999 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | tert-butyl 4-[2-[cyclopropyl(prop-2-enyl)amino]-1-hydroxy-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | C=CCN(C(=O)C(O)C1CCN(C(=O)OC(C)(C)C)CC1)C1CC1 |
| InChI | InChI=1S/C18H30N2O4/c1-5-10-20(14-6-7-14)16(22)15(21)13-8-11-19(12-9-13)17(23)24-18(2,3)4/h5,13-15,21H,1,6-12H2,2-4H3 |
| InChIKey | AKSORYXMIAJNOY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|