C20H18F3N3O4S2 — CID 166747826
N-[1,1-dihydroxy-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ4,2-benzoxathiazepin-8-yl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 166747826) has the molecular formula C20H18F3N3O4S2 and a molecular weight of 485.51 g/mol. Its IUPAC name is N-[1,1-dihydroxy-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ4,2-benzoxathiazepin-8-yl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1,1-dihydroxy-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ4,2-benzoxathiazepin-8-yl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 166747826 |
| Molecular Formula | C20H18F3N3O4S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | N-[1,1-dihydroxy-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ4,2-benzoxathiazepin-8-yl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)Nc1ccc2c(c1)S(O)(O)N(c1ccc(C(F)(F)F)cc1)CCO2 |
| InChI | InChI=1S/C20H18F3N3O4S2/c1-12-18(31-11-24-12)19(27)25-14-4-7-16-17(10-14)32(28,29)26(8-9-30-16)15-5-2-13(3-6-15)20(21,22)23/h2-7,10-11,28-29H,8-9H2,1H3,(H,25,27) |
| InChIKey | PGYDPJIVCOPUGG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |