C20H16F3N3O5S2 — CID 168838370
N-[1,1-dioxo-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepin-8-yl]-2-(hydroxymethyl)-1,3-thiazole-4-carboxamide (PubChem CID 168838370) has the molecular formula C20H16F3N3O5S2 and a molecular weight of 499.49 g/mol. Its IUPAC name is N-[1,1-dioxo-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepin-8-yl]-2-(hydroxymethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[1,1-dioxo-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepin-8-yl]-2-(hydroxymethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 168838370 |
| Molecular Formula | C20H16F3N3O5S2 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | N-[1,1-dioxo-2-[4-(trifluoromethyl)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepin-8-yl]-2-(hydroxymethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)S(=O)(=O)N(c1ccc(C(F)(F)F)cc1)CCO2)c1csc(CO)n1 |
| InChI | InChI=1S/C20H16F3N3O5S2/c21-20(22,23)12-1-4-14(5-2-12)26-7-8-31-16-6-3-13(9-17(16)33(26,29)30)24-19(28)15-11-32-18(10-27)25-15/h1-6,9,11,27H,7-8,10H2,(H,24,28) |
| InChIKey | NSAOPNYPECEARM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |