C29H46N3O9P — CID 166748617
[(2S)-3-cyclohexyl-1-[[(2S)-1-diethoxyphosphoryl-1-hydroxy-5-oxo-5-(2-phenylmorpholin-4-yl)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid (PubChem CID 166748617) has the molecular formula C29H46N3O9P and a molecular weight of 611.67 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-1-[[(2S)-1-diethoxyphosphoryl-1-hydroxy-5-oxo-5-(2-phenylmorpholin-4-yl)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-cyclohexyl-1-[[(2S)-1-diethoxyphosphoryl-1-hydroxy-5-oxo-5-(2-phenylmorpholin-4-yl)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 166748617 |
| Molecular Formula | C29H46N3O9P |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | [(2S)-3-cyclohexyl-1-[[(2S)-1-diethoxyphosphoryl-1-hydroxy-5-oxo-5-(2-phenylmorpholin-4-yl)pentan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid |
| SMILES | CCOP(=O)(OCC)C(O)[C@H](CCC(=O)N1CCOC(c2ccccc2)C1)NC(=O)[C@H](CC1CCCCC1)NC(=O)O |
| InChI | InChI=1S/C29H46N3O9P/c1-3-40-42(38,41-4-2)28(35)23(30-27(34)24(31-29(36)37)19-21-11-7-5-8-12-21)15-16-26(33)32-17-18-39-25(20-32)22-13-9-6-10-14-22/h6,9-10,13-14,21,23-25,28,31,35H,3-5,7-8,11-12,15-20H2,1-2H3,(H,30,34)(H,36,37)/t23-,24-,25?,28?/m0/s1 |
| InChIKey | XGIGDKLQIPJXNJ-BLNFBIEVSA-N |
| XLogP | 4.04 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|