C28H32ClFN6O — CID 166749928
N-[(Z)-2-[3-chloro-6-[(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]ethylideneamino]-N-ethenylpiperidin-4-amine (PubChem CID 166749928) has the molecular formula C28H32ClFN6O and a molecular weight of 523.06 g/mol. Its IUPAC name is N-[(Z)-2-[3-chloro-6-[(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]ethylideneamino]-N-ethenylpiperidin-4-amine.
| Compound Name | N-[(Z)-2-[3-chloro-6-[(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]ethylideneamino]-N-ethenylpiperidin-4-amine |
|---|---|
| PubChem CID | 166749928 |
| Molecular Formula | C28H32ClFN6O |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[(Z)-2-[3-chloro-6-[(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]ethylideneamino]-N-ethenylpiperidin-4-amine |
| SMILES | C=CN(/N=C\Cc1c(Cl)cnc2ccc(N3CCC[C@@H]3c3cc(F)ccc3OC)nc12)C1CCNCC1 |
| InChI | InChI=1S/C28H32ClFN6O/c1-3-36(20-10-13-31-14-11-20)33-15-12-21-23(29)18-32-24-7-9-27(34-28(21)24)35-16-4-5-25(35)22-17-19(30)6-8-26(22)37-2/h3,6-9,15,17-18,20,25,31H,1,4-5,10-14,16H2,2H3/b33-15-/t25-/m1/s1 |
| InChIKey | NFVIJTBVSPGXHH-WSRVDXEQSA-N |
| XLogP | 5.50 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|