C23H22FN5O — CID 156683436
(6R,16S)-9-fluoro-19-isocyano-16-methyl-13-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,18(26),19,21,23-octaene (PubChem CID 156683436) has the molecular formula C23H22FN5O and a molecular weight of 403.46 g/mol. Its IUPAC name is (6R,16S)-9-fluoro-19-isocyano-16-methyl-13-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,18(26),19,21,23-octaene.
| Compound Name | (6R,16S)-9-fluoro-19-isocyano-16-methyl-13-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,18(26),19,21,23-octaene |
|---|---|
| PubChem CID | 156683436 |
| Molecular Formula | C23H22FN5O |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (6R,16S)-9-fluoro-19-isocyano-16-methyl-13-oxa-2,17,21,25-tetrazapentacyclo[16.6.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,18(26),19,21,23-octaene |
| SMILES | [C-]#[N+]c1cnc2ccc3nc2c1N[C@@H](C)CCOc1ccc(F)cc1[C@H]1CCCN31 |
| InChI | InChI=1S/C23H22FN5O/c1-14-9-11-30-20-7-5-15(24)12-16(20)19-4-3-10-29(19)21-8-6-17-22(28-21)23(27-14)18(25-2)13-26-17/h5-8,12-14,19,27H,3-4,9-11H2,1H3/t14-,19+/m0/s1 |
| InChIKey | DSQDFTJNLWUFAX-IFXJQAMLSA-N |
| XLogP | 5.24 |
| TPSA | 54.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|