C20H22FN6O+ — CID 168795623
(6R,15R)-9-fluoro-15-methyl-2,11,16,20,24-pentaza-21-azoniapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,19,21(25),22-heptaen-17-one (PubChem CID 168795623) has the molecular formula C20H22FN6O+ and a molecular weight of 381.44 g/mol. Its IUPAC name is (6R,15R)-9-fluoro-15-methyl-2,11,16,20,24-pentaza-21-azoniapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,19,21(25),22-heptaen-17-one.
| Compound Name | (6R,15R)-9-fluoro-15-methyl-2,11,16,20,24-pentaza-21-azoniapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,19,21(25),22-heptaen-17-one |
|---|---|
| PubChem CID | 168795623 |
| Molecular Formula | C20H22FN6O+ |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (6R,15R)-9-fluoro-15-methyl-2,11,16,20,24-pentaza-21-azoniapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,19,21(25),22-heptaen-17-one |
| SMILES | C[C@@H]1CCc2ncc(F)cc2[C@H]2CCCN2c2cc[n+]3c(n2)C(C=N3)C(=O)N1 |
| InChI | InChI=1S/C20H21FN6O/c1-12-4-5-16-14(9-13(21)10-22-16)17-3-2-7-26(17)18-6-8-27-19(25-18)15(11-23-27)20(28)24-12/h6,8-12,15,17H,2-5,7H2,1H3/p+1/t12-,15?,17-/m1/s1 |
| InChIKey | XAEBXQHVFJYJAD-XURPUJGUSA-O |
| XLogP | 1.63 |
| TPSA | 74.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|