C23H24F2N4O — CID 175746907
1-[[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]amino]cyclopentan-1-ol (PubChem CID 175746907) has the molecular formula C23H24F2N4O and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]amino]cyclopentan-1-ol.
| Compound Name | 1-[[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 175746907 |
| Molecular Formula | C23H24F2N4O |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-[[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1,5-naphthyridin-4-yl]amino]cyclopentan-1-ol |
| SMILES | OC1(Nc2ccnc3ccc(N4CCC[C@@H]4c4cc(F)ccc4F)nc23)CCCC1 |
| InChI | InChI=1S/C23H24F2N4O/c24-15-5-6-17(25)16(14-15)20-4-3-13-29(20)21-8-7-18-22(27-21)19(9-12-26-18)28-23(30)10-1-2-11-23/h5-9,12,14,20,30H,1-4,10-11,13H2,(H,26,28)/t20-/m1/s1 |
| InChIKey | JIAMRFMBDDWCOA-HXUWFJFHSA-N |
| XLogP | 4.92 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|