C25H22Cl2N6O5S — CID 166753937
4-[(2,6-dichlorobenzoyl)amino]-N-[1-[3-(prop-2-enoylamino)phenyl]sulfonylpiperidin-3-ylidene]-1H-pyrazole-5-carboxamide (PubChem CID 166753937) has the molecular formula C25H22Cl2N6O5S and a molecular weight of 589.46 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-N-[1-[3-(prop-2-enoylamino)phenyl]sulfonylpiperidin-3-ylidene]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[1-[3-(prop-2-enoylamino)phenyl]sulfonylpiperidin-3-ylidene]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166753937 |
| Molecular Formula | C25H22Cl2N6O5S |
| Molecular Weight | 589.46 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[1-[3-(prop-2-enoylamino)phenyl]sulfonylpiperidin-3-ylidene]-1H-pyrazole-5-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(S(=O)(=O)N2CCC/C(=N\C(=O)c3[nH]ncc3NC(=O)c3c(Cl)cccc3Cl)C2)c1 |
| InChI | InChI=1S/C25H22Cl2N6O5S/c1-2-21(34)29-15-6-3-8-17(12-15)39(37,38)33-11-5-7-16(14-33)30-25(36)23-20(13-28-32-23)31-24(35)22-18(26)9-4-10-19(22)27/h2-4,6,8-10,12-13H,1,5,7,11,14H2,(H,28,32)(H,29,34)(H,31,35)/b30-16+ |
| InChIKey | DZZVTEWKBAYKHQ-OKCVXOCRSA-N |
| XLogP | 4.16 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|