C21H35N — CID 166754054
2-methyl-6-[5-(3-propan-2-ylphenyl)hexan-2-yl]piperidine (PubChem CID 166754054) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is 2-methyl-6-[5-(3-propan-2-ylphenyl)hexan-2-yl]piperidine.
| Compound Name | 2-methyl-6-[5-(3-propan-2-ylphenyl)hexan-2-yl]piperidine |
|---|---|
| PubChem CID | 166754054 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 2-methyl-6-[5-(3-propan-2-ylphenyl)hexan-2-yl]piperidine |
| SMILES | CC1CCCC(C(C)CCC(C)c2cccc(C(C)C)c2)N1 |
| InChI | InChI=1S/C21H35N/c1-15(2)19-9-7-10-20(14-19)16(3)12-13-17(4)21-11-6-8-18(5)22-21/h7,9-10,14-18,21-22H,6,8,11-13H2,1-5H3 |
| InChIKey | MTIHTXMGYRRRJB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |