About ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate
ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate (PubChem CID 166757529) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate |
| PubChem CID | 166757529 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate |
| SMILES | C#CC1[C@H]2CN(CCCC(=O)OCC)C[C@@H]12 |
| InChI | InChI=1S/C13H19NO2/c1-3-10-11-8-14(9-12(10)11)7-5-6-13(15)16-4-2/h1,10-12H,4-9H2,2H3/t10?,11-,12+ |
| InChIKey | DOZOQINUYYWJFX-YOGCLGLASA-N |
| XLogP | 1.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate?
The IUPAC name of ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate (CID 166757529) is ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate.
What is the SMILES notation for ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate?
The canonical SMILES for ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate is C#CC1[C@H]2CN(CCCC(=O)OCC)C[C@@H]12.
What is the InChIKey of ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate?
The InChIKey is DOZOQINUYYWJFX-YOGCLGLASA-N. The full InChI is InChI=1S/C13H19NO2/c1-3-10-11-8-14(9-12(10)11)7-5-6-13(15)16-4-2/h1,10-12H,4-9H2,2H3/t10?,11-,12+.
What are the key properties of ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate?
ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate has a molecular weight of 221.30 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(1R,5S)-6-ethynyl-3-azabicyclo[3.1.0]hexan-3-yl]butanoate is sourced from PubChem (CID 166757529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).