C16H27ClN2O — CID 166758463
[2-amino-1-(2,6-dimethylphenyl)-2-oxoethyl]-triethylazanium chloride (PubChem CID 166758463) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is [2-amino-1-(2,6-dimethylphenyl)-2-oxoethyl]-triethylazanium chloride.
| Compound Name | [2-amino-1-(2,6-dimethylphenyl)-2-oxoethyl]-triethylazanium chloride |
|---|---|
| PubChem CID | 166758463 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [2-amino-1-(2,6-dimethylphenyl)-2-oxoethyl]-triethylazanium chloride |
| SMILES | CC[N+](CC)(CC)C(C(N)=O)c1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C16H26N2O.ClH/c1-6-18(7-2,8-3)15(16(17)19)14-12(4)10-9-11-13(14)5;/h9-11,15H,6-8H2,1-5H3,(H-,17,19);1H |
| InChIKey | YPSPPUCNBRQTDN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|