C15H23NO — CID 86618512
2-(2-ethyl-6-methylphenyl)-3,3-dimethylbutanamide (PubChem CID 86618512) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 2-(2-ethyl-6-methylphenyl)-3,3-dimethylbutanamide.
| Compound Name | 2-(2-ethyl-6-methylphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 86618512 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-(2-ethyl-6-methylphenyl)-3,3-dimethylbutanamide |
| SMILES | CCc1cccc(C)c1C(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C15H23NO/c1-6-11-9-7-8-10(2)12(11)13(14(16)17)15(3,4)5/h7-9,13H,6H2,1-5H3,(H2,16,17) |
| InChIKey | DQPSWGQDSDFKPG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |