C12H16ClNO — CID 70479437
2-chloro-2-(2,6-diethylphenyl)acetamide (PubChem CID 70479437) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 2-chloro-2-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-chloro-2-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 70479437 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-chloro-2-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1C(Cl)C(N)=O |
| InChI | InChI=1S/C12H16ClNO/c1-3-8-6-5-7-9(4-2)10(8)11(13)12(14)15/h5-7,11H,3-4H2,1-2H3,(H2,14,15) |
| InChIKey | ARCFWJGKWQVTCW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|