C14H19BrClNO — CID 57370521
2-bromo-6-chloro-6-(2,6-dimethylphenyl)hexanamide (PubChem CID 57370521) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is 2-bromo-6-chloro-6-(2,6-dimethylphenyl)hexanamide.
| Compound Name | 2-bromo-6-chloro-6-(2,6-dimethylphenyl)hexanamide |
|---|---|
| PubChem CID | 57370521 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-bromo-6-chloro-6-(2,6-dimethylphenyl)hexanamide |
| SMILES | Cc1cccc(C)c1C(Cl)CCCC(Br)C(N)=O |
| InChI | InChI=1S/C14H19BrClNO/c1-9-5-3-6-10(2)13(9)12(16)8-4-7-11(15)14(17)18/h3,5-6,11-12H,4,7-8H2,1-2H3,(H2,17,18) |
| InChIKey | FQDXQEUDMCTJRZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|