C89H57N9 — CID 166759249
9-[4-[2,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(3,6-diphenylcarbazol-9-yl)-2-pyridinyl]-3,6-diphenylcarbazole (PubChem CID 166759249) has the molecular formula C89H57N9 and a molecular weight of 1252.50 g/mol. Its IUPAC name is 9-[4-[2,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(3,6-diphenylcarbazol-9-yl)-2-pyridinyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[4-[2,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(3,6-diphenylcarbazol-9-yl)-2-pyridinyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 166759249 |
| Molecular Formula | C89H57N9 |
| Molecular Weight | 1252.50 g/mol |
| Exact Mass | 1251.47 |
| IUPAC Name | 9-[4-[2,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-(3,6-diphenylcarbazol-9-yl)-2-pyridinyl]-3,6-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)cn2)cc1 |
| InChI | InChI=1S/C89H57N9/c1-9-26-58(27-10-1)66-44-48-77-72(52-66)73-53-67(59-28-11-2-12-29-59)45-49-78(73)97(77)81-57-90-82(98-79-50-46-68(60-30-13-3-14-31-60)54-74(79)75-55-69(47-51-80(75)98)61-32-15-4-16-33-61)56-76(81)70-42-25-43-71(88-93-84(62-34-17-5-18-35-62)91-85(94-88)63-36-19-6-20-37-63)83(70)89-95-86(64-38-21-7-22-39-64)92-87(96-89)65-40-23-8-24-41-65/h1-57H |
| InChIKey | GJGLZQXLBKNYEY-UHFFFAOYSA-N |
| XLogP | 21.98 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1252.50 |
| LogP ≤ 5 | 21.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |